C28H22N2O2 — CID 15476515
5-amino-16-cyclohexyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 15476515) has the molecular formula C28H22N2O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-amino-16-cyclohexyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 5-amino-16-cyclohexyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 15476515 |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 5-amino-16-cyclohexyl-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | Nc1ccc2c3ccc4c5c(ccc(c6cccc1c62)c53)C(=O)N(C1CCCCC1)C4=O |
| InChI | InChI=1S/C28H22N2O2/c29-23-14-13-17-19-10-12-22-26-21(27(31)30(28(22)32)15-5-2-1-3-6-15)11-9-18(25(19)26)16-7-4-8-20(23)24(16)17/h4,7-15H,1-3,5-6,29H2 |
| InChIKey | QAJWHQGOFOGIJX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|