About (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone
(3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone (PubChem CID 154765171) has the molecular formula C14H18N4O4
and a molecular weight of 306.32 g/mol. Its IUPAC name is (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone |
| PubChem CID | 154765171 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone |
| SMILES | CCOc1cc(C(=O)N2C[C@H](OC)CC2c2ncc[nH]2)on1 |
| InChI | InChI=1S/C14H18N4O4/c1-3-21-12-7-11(22-17-12)14(19)18-8-9(20-2)6-10(18)13-15-4-5-16-13/h4-5,7,9-10H,3,6,8H2,1-2H3,(H,15,16)/t9-,10?/m1/s1 |
| InChIKey | OOHKPCMJTQPESG-YHMJZVADSA-N |
| XLogP | 1.40 |
| TPSA | 93.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone?
The IUPAC name of (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone (CID 154765171) is (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone.
What is the SMILES notation for (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone?
The canonical SMILES for (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone is CCOc1cc(C(=O)N2C[C@H](OC)CC2c2ncc[nH]2)on1.
What is the InChIKey of (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone?
The InChIKey is OOHKPCMJTQPESG-YHMJZVADSA-N. The full InChI is InChI=1S/C14H18N4O4/c1-3-21-12-7-11(22-17-12)14(19)18-8-9(20-2)6-10(18)13-15-4-5-16-13/h4-5,7,9-10H,3,6,8H2,1-2H3,(H,15,16)/t9-,10?/m1/s1.
What are the key properties of (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone?
(3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone has a molecular weight of 306.32 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-1,2-oxazol-5-yl)-[(4R)-2-(1H-imidazol-2-yl)-4-methoxypyrrolidin-1-yl]methanone is sourced from PubChem (CID 154765171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).