C38H38N2O6 — CID 15476518
butan-2-yl N-butan-2-yloxycarbonyl-N-(16-cyclohexyl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaen-5-yl)carbamate (PubChem CID 15476518) has the molecular formula C38H38N2O6 and a molecular weight of 618.73 g/mol. Its IUPAC name is butan-2-yl N-butan-2-yloxycarbonyl-N-(16-cyclohexyl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaen-5-yl)carbamate.
| Compound Name | butan-2-yl N-butan-2-yloxycarbonyl-N-(16-cyclohexyl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaen-5-yl)carbamate |
|---|---|
| PubChem CID | 15476518 |
| Molecular Formula | C38H38N2O6 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | butan-2-yl N-butan-2-yloxycarbonyl-N-(16-cyclohexyl-15,17-dioxo-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaen-5-yl)carbamate |
| SMILES | CCC(C)OC(=O)N(C(=O)OC(C)CC)c1ccc2c3ccc4c5c(ccc(c6cccc1c62)c53)C(=O)N(C1CCCCC1)C4=O |
| InChI | InChI=1S/C38H38N2O6/c1-5-21(3)45-37(43)40(38(44)46-22(4)6-2)31-20-19-25-27-16-18-30-34-29(35(41)39(36(30)42)23-11-8-7-9-12-23)17-15-26(33(27)34)24-13-10-14-28(31)32(24)25/h10,13-23H,5-9,11-12H2,1-4H3 |
| InChIKey | VSKOMBLKTVHYOB-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|