C13H14ClN5O2S — CID 154765930
(9S)-5-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 154765930) has the molecular formula C13H14ClN5O2S and a molecular weight of 339.81 g/mol. Its IUPAC name is (9S)-5-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (9S)-5-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 154765930 |
| Molecular Formula | C13H14ClN5O2S |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (9S)-5-chloro-8-(2-methylpyrazol-3-yl)sulfonyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Cn1nccc1S(=O)(=O)N1c2nc(Cl)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C13H14ClN5O2S/c1-17-12(4-6-15-17)22(20,21)19-9-5-7-18(8-9)10-2-3-11(14)16-13(10)19/h2-4,6,9H,5,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | FIWGQYGLPXLXDZ-VIFPVBQESA-N |
| XLogP | 1.26 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|