C11H11Cl2N3O3S — CID 154765972
N-(2,1,3-benzoxadiazol-4-yl)-1-(2,2-dichloro-1-methylcyclopropyl)methanesulfonamide (PubChem CID 154765972) has the molecular formula C11H11Cl2N3O3S and a molecular weight of 336.20 g/mol. Its IUPAC name is N-(2,1,3-benzoxadiazol-4-yl)-1-(2,2-dichloro-1-methylcyclopropyl)methanesulfonamide.
| Compound Name | N-(2,1,3-benzoxadiazol-4-yl)-1-(2,2-dichloro-1-methylcyclopropyl)methanesulfonamide |
|---|---|
| PubChem CID | 154765972 |
| Molecular Formula | C11H11Cl2N3O3S |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | N-(2,1,3-benzoxadiazol-4-yl)-1-(2,2-dichloro-1-methylcyclopropyl)methanesulfonamide |
| SMILES | CC1(CS(=O)(=O)Nc2cccc3nonc23)CC1(Cl)Cl |
| InChI | InChI=1S/C11H11Cl2N3O3S/c1-10(5-11(10,12)13)6-20(17,18)16-8-4-2-3-7-9(8)15-19-14-7/h2-4,16H,5-6H2,1H3 |
| InChIKey | DKKISWQBMQURHG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|