C9H8N4O — CID 154766209
N-([1,2,4]triazolo[1,5-a]pyridin-2-yl)prop-2-enamide (PubChem CID 154766209) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is N-([1,2,4]triazolo[1,5-a]pyridin-2-yl)prop-2-enamide.
| Compound Name | N-([1,2,4]triazolo[1,5-a]pyridin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 154766209 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | N-([1,2,4]triazolo[1,5-a]pyridin-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2ccccn2n1 |
| InChI | InChI=1S/C9H8N4O/c1-2-8(14)11-9-10-7-5-3-4-6-13(7)12-9/h2-6H,1H2,(H,11,12,14) |
| InChIKey | OVIUGEJTXANLDS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|