C11H7F3N2OS — CID 154766225
N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide (PubChem CID 154766225) has the molecular formula C11H7F3N2OS and a molecular weight of 272.25 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154766225 |
| Molecular Formula | C11H7F3N2OS |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-[4-(trifluoromethyl)-1,3-benzothiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc2c(C(F)(F)F)cccc2s1 |
| InChI | InChI=1S/C11H7F3N2OS/c1-2-8(17)15-10-16-9-6(11(12,13)14)4-3-5-7(9)18-10/h2-5H,1H2,(H,15,16,17) |
| InChIKey | QKHOVWQBADMQBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|