About tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate
tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate (PubChem CID 154766241) has the molecular formula C16H24N6O3
and a molecular weight of 348.41 g/mol. Its IUPAC name is tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate |
| PubChem CID | 154766241 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate |
| SMILES | Cc1noc(Cn2cc(CN3CCCC3C(=O)OC(C)(C)C)nn2)n1 |
| InChI | InChI=1S/C16H24N6O3/c1-11-17-14(25-19-11)10-22-9-12(18-20-22)8-21-7-5-6-13(21)15(23)24-16(2,3)4/h9,13H,5-8,10H2,1-4H3 |
| InChIKey | RIRNOXNJJQBAEQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate?
The IUPAC name of tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate (CID 154766241) is tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate?
The canonical SMILES for tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate is Cc1noc(Cn2cc(CN3CCCC3C(=O)OC(C)(C)C)nn2)n1.
What is the InChIKey of tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate?
The InChIKey is RIRNOXNJJQBAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N6O3/c1-11-17-14(25-19-11)10-22-9-12(18-20-22)8-21-7-5-6-13(21)15(23)24-16(2,3)4/h9,13H,5-8,10H2,1-4H3.
What are the key properties of tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate?
tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate has a molecular weight of 348.41 g/mol, XLogP of 1.32, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1-[[1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]triazol-4-yl]methyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 154766241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).