C16H21N3O3 — CID 154766334
6-[1-[(1-cyclopropyl-2-methoxyethyl)amino]ethyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 154766334) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 6-[1-[(1-cyclopropyl-2-methoxyethyl)amino]ethyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[1-[(1-cyclopropyl-2-methoxyethyl)amino]ethyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 154766334 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 6-[1-[(1-cyclopropyl-2-methoxyethyl)amino]ethyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | COCC(NC(C)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)C1CC1 |
| InChI | InChI=1S/C16H21N3O3/c1-9(17-14(8-22-2)10-3-4-10)11-5-6-12-13(7-11)19-16(21)15(20)18-12/h5-7,9-10,14,17H,3-4,8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | OMQVTZDJCMOSLF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|