C19H27N3O2 — CID 154767215
N-(cyclopropylmethyl)-2-[(2-methyl-3-pyridinyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide (PubChem CID 154767215) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[(2-methyl-3-pyridinyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-2-[(2-methyl-3-pyridinyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide |
|---|---|
| PubChem CID | 154767215 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[(2-methyl-3-pyridinyl)methyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxamide |
| SMILES | Cc1ncccc1CN1CC2COCCC2(C(=O)NCC2CC2)C1 |
| InChI | InChI=1S/C19H27N3O2/c1-14-16(3-2-7-20-14)10-22-11-17-12-24-8-6-19(17,13-22)18(23)21-9-15-4-5-15/h2-3,7,15,17H,4-6,8-13H2,1H3,(H,21,23) |
| InChIKey | QRKIHXFUIFOJEE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |