About 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one
1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one (PubChem CID 154767285) has the molecular formula C16H21F3N4O2
and a molecular weight of 358.36 g/mol. Its IUPAC name is 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one |
| PubChem CID | 154767285 |
| Molecular Formula | C16H21F3N4O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one |
| SMILES | O=C(C(CNc1ncc(F)cn1)C1CCOCC1)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C16H21F3N4O2/c17-12-7-20-15(21-8-12)22-9-13(11-1-5-25-6-2-11)14(24)23-4-3-16(18,19)10-23/h7-8,11,13H,1-6,9-10H2,(H,20,21,22) |
| InChIKey | OXBKLDHJVKBPHL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one?
The IUPAC name of 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one (CID 154767285) is 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one.
What is the SMILES notation for 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one?
The canonical SMILES for 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one is O=C(C(CNc1ncc(F)cn1)C1CCOCC1)N1CCC(F)(F)C1.
What is the InChIKey of 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one?
The InChIKey is OXBKLDHJVKBPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3N4O2/c17-12-7-20-15(21-8-12)22-9-13(11-1-5-25-6-2-11)14(24)23-4-3-16(18,19)10-23/h7-8,11,13H,1-6,9-10H2,(H,20,21,22).
What are the key properties of 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one?
1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one has a molecular weight of 358.36 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-difluoropyrrolidin-1-yl)-3-[(5-fluoropyrimidin-2-yl)amino]-2-(oxan-4-yl)propan-1-one is sourced from PubChem (CID 154767285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).