C16H21N7O — CID 154767551
(1R,2R,4S)-2-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-ol (PubChem CID 154767551) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is (1R,2R,4S)-2-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-ol.
| Compound Name | (1R,2R,4S)-2-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 154767551 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (1R,2R,4S)-2-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]-4-(4-methyl-1,2,4-triazol-3-yl)cyclopentan-1-ol |
| SMILES | Cc1cc2c(NC[C@H]3C[C@H](c4nncn4C)C[C@H]3O)nccn2n1 |
| InChI | InChI=1S/C16H21N7O/c1-10-5-13-15(17-3-4-23(13)21-10)18-8-12-6-11(7-14(12)24)16-20-19-9-22(16)2/h3-5,9,11-12,14,24H,6-8H2,1-2H3,(H,17,18)/t11-,12+,14+/m0/s1 |
| InChIKey | RCMAMSWMTMOBBP-OUCADQQQSA-N |
| XLogP | 1.13 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |