C18H26N4O3 — CID 154768266
2-(cyclohexen-1-yl)-1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]azetidin-1-yl]ethanone (PubChem CID 154768266) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]azetidin-1-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154768266 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)morpholin-4-yl]azetidin-1-yl]ethanone |
| SMILES | Cc1noc(C2COCCN2C2CN(C(=O)CC3=CCCCC3)C2)n1 |
| InChI | InChI=1S/C18H26N4O3/c1-13-19-18(25-20-13)16-12-24-8-7-22(16)15-10-21(11-15)17(23)9-14-5-3-2-4-6-14/h5,15-16H,2-4,6-12H2,1H3 |
| InChIKey | FIBASIGGIPPTHW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|