C16H21N3O3 — CID 154768487
(2R,5S)-1-benzyl-2-N-(oxetan-3-yl)pyrrolidine-2,5-dicarboxamide (PubChem CID 154768487) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is (2R,5S)-1-benzyl-2-N-(oxetan-3-yl)pyrrolidine-2,5-dicarboxamide.
| Compound Name | (2R,5S)-1-benzyl-2-N-(oxetan-3-yl)pyrrolidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 154768487 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2R,5S)-1-benzyl-2-N-(oxetan-3-yl)pyrrolidine-2,5-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CC[C@H](C(=O)NC2COC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H21N3O3/c17-15(20)13-6-7-14(16(21)18-12-9-22-10-12)19(13)8-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2,(H2,17,20)(H,18,21)/t13-,14+/m0/s1 |
| InChIKey | ROUMCVWSODHUEW-UONOGXRCSA-N |
| XLogP | 0.02 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |