C18H20FN3O3 — CID 154769463
3-(3-but-3-ynyldiazirin-3-yl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]propanamide (PubChem CID 154769463) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 154769463 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[2-(6-fluoro-4H-1,3-benzodioxin-8-yl)ethyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NCCc2cc(F)cc3c2OCOC3)N=N1 |
| InChI | InChI=1S/C18H20FN3O3/c1-2-3-6-18(21-22-18)7-4-16(23)20-8-5-13-9-15(19)10-14-11-24-12-25-17(13)14/h1,9-10H,3-8,11-12H2,(H,20,23) |
| InChIKey | NBIYQWISHXMHKY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|