C13H15BrF2N2O2 — CID 154769816
1-(6-bromo-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-3-(2,2-difluoroethoxy)propan-1-one (PubChem CID 154769816) has the molecular formula C13H15BrF2N2O2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 1-(6-bromo-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-3-(2,2-difluoroethoxy)propan-1-one.
| Compound Name | 1-(6-bromo-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 154769816 |
| Molecular Formula | C13H15BrF2N2O2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1-(6-bromo-3,4-dihydro-2H-1,8-naphthyridin-1-yl)-3-(2,2-difluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)F)N1CCCc2cc(Br)cnc21 |
| InChI | InChI=1S/C13H15BrF2N2O2/c14-10-6-9-2-1-4-18(13(9)17-7-10)12(19)3-5-20-8-11(15)16/h6-7,11H,1-5,8H2 |
| InChIKey | FPRVQAFWHPQXAD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|