C16H25N3O4 — CID 154770120
oxolan-2-ylmethyl N-[[1-(hydroxymethyl)cyclobutyl]-(1-methylpyrazol-4-yl)methyl]carbamate (PubChem CID 154770120) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is oxolan-2-ylmethyl N-[[1-(hydroxymethyl)cyclobutyl]-(1-methylpyrazol-4-yl)methyl]carbamate.
| Compound Name | oxolan-2-ylmethyl N-[[1-(hydroxymethyl)cyclobutyl]-(1-methylpyrazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 154770120 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | oxolan-2-ylmethyl N-[[1-(hydroxymethyl)cyclobutyl]-(1-methylpyrazol-4-yl)methyl]carbamate |
| SMILES | Cn1cc(C(NC(=O)OCC2CCCO2)C2(CO)CCC2)cn1 |
| InChI | InChI=1S/C16H25N3O4/c1-19-9-12(8-17-19)14(16(11-20)5-3-6-16)18-15(21)23-10-13-4-2-7-22-13/h8-9,13-14,20H,2-7,10-11H2,1H3,(H,18,21) |
| InChIKey | YYCGJCSOASJQJV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |