C15H24N4O3 — CID 154770154
1-(1-methyl-6-oxopyridazin-4-yl)-3-[(2-propan-2-yloxan-3-yl)methyl]urea (PubChem CID 154770154) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-(1-methyl-6-oxopyridazin-4-yl)-3-[(2-propan-2-yloxan-3-yl)methyl]urea.
| Compound Name | 1-(1-methyl-6-oxopyridazin-4-yl)-3-[(2-propan-2-yloxan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 154770154 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 1-(1-methyl-6-oxopyridazin-4-yl)-3-[(2-propan-2-yloxan-3-yl)methyl]urea |
| SMILES | CC(C)C1OCCCC1CNC(=O)Nc1cnn(C)c(=O)c1 |
| InChI | InChI=1S/C15H24N4O3/c1-10(2)14-11(5-4-6-22-14)8-16-15(21)18-12-7-13(20)19(3)17-9-12/h7,9-11,14H,4-6,8H2,1-3H3,(H2,16,18,21) |
| InChIKey | JOTHTLDYPFMGGK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |