C14H25N5O2 — CID 154770335
1-(3-methoxy-1-methylpyrazol-4-yl)-3-[(1-methylazepan-3-yl)methyl]urea (PubChem CID 154770335) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 1-(3-methoxy-1-methylpyrazol-4-yl)-3-[(1-methylazepan-3-yl)methyl]urea.
| Compound Name | 1-(3-methoxy-1-methylpyrazol-4-yl)-3-[(1-methylazepan-3-yl)methyl]urea |
|---|---|
| PubChem CID | 154770335 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 1-(3-methoxy-1-methylpyrazol-4-yl)-3-[(1-methylazepan-3-yl)methyl]urea |
| SMILES | COc1nn(C)cc1NC(=O)NCC1CCCCN(C)C1 |
| InChI | InChI=1S/C14H25N5O2/c1-18-7-5-4-6-11(9-18)8-15-14(20)16-12-10-19(2)17-13(12)21-3/h10-11H,4-9H2,1-3H3,(H2,15,16,20) |
| InChIKey | WXZVKPSYHJBHDW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |