About 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one
2-but-3-enyl-2,6,6-trimethylpiperidin-4-one (PubChem CID 15477037) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one.
Molecular Properties
| Compound Name | 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one |
| PubChem CID | 15477037 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one |
| SMILES | C=CCCC1(C)CC(=O)CC(C)(C)N1 |
| InChI | InChI=1S/C12H21NO/c1-5-6-7-12(4)9-10(14)8-11(2,3)13-12/h5,13H,1,6-9H2,2-4H3 |
| InChIKey | ZJXJGGHHMAWSFQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one?
The IUPAC name of 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one (CID 15477037) is 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one.
What is the SMILES notation for 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one?
The canonical SMILES for 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one is C=CCCC1(C)CC(=O)CC(C)(C)N1.
What is the InChIKey of 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one?
The InChIKey is ZJXJGGHHMAWSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-5-6-7-12(4)9-10(14)8-11(2,3)13-12/h5,13H,1,6-9H2,2-4H3.
What are the key properties of 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one?
2-but-3-enyl-2,6,6-trimethylpiperidin-4-one has a molecular weight of 195.31 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enyl-2,6,6-trimethylpiperidin-4-one is sourced from PubChem (CID 15477037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).