C15H24N4O — CID 154770731
1-[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-ethyl-1H-imidazol-2-yl)ethanone (PubChem CID 154770731) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-ethyl-1H-imidazol-2-yl)ethanone.
| Compound Name | 1-[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-ethyl-1H-imidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 154770731 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-[(3aR,6aS)-2,3a-dimethyl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(5-ethyl-1H-imidazol-2-yl)ethanone |
| SMILES | CCc1cnc(CC(=O)N2C[C@@H]3CN(C)C[C@]3(C)C2)[nH]1 |
| InChI | InChI=1S/C15H24N4O/c1-4-12-6-16-13(17-12)5-14(20)19-8-11-7-18(3)9-15(11,2)10-19/h6,11H,4-5,7-10H2,1-3H3,(H,16,17)/t11-,15+/m0/s1 |
| InChIKey | DUGYFHHPDIJJMJ-XHDPSFHLSA-N |
| XLogP | 0.92 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |