C17H29N3O2S — CID 154770803
N-methyl-N-[1-[[6-(2-methylpropyl)-3-pyridinyl]methyl]piperidin-4-yl]methanesulfonamide (PubChem CID 154770803) has the molecular formula C17H29N3O2S and a molecular weight of 339.51 g/mol. Its IUPAC name is N-methyl-N-[1-[[6-(2-methylpropyl)-3-pyridinyl]methyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-methyl-N-[1-[[6-(2-methylpropyl)-3-pyridinyl]methyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 154770803 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | N-methyl-N-[1-[[6-(2-methylpropyl)-3-pyridinyl]methyl]piperidin-4-yl]methanesulfonamide |
| SMILES | CC(C)Cc1ccc(CN2CCC(N(C)S(C)(=O)=O)CC2)cn1 |
| InChI | InChI=1S/C17H29N3O2S/c1-14(2)11-16-6-5-15(12-18-16)13-20-9-7-17(8-10-20)19(3)23(4,21)22/h5-6,12,14,17H,7-11,13H2,1-4H3 |
| InChIKey | OEUHPSDETWAYRL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |