C22H22ClN3O6S — CID 154771102
[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 154771102) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 154771102 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | CN(c1ccc(OC(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O6S/c1-25(33(30,31)18-10-4-15(23)5-11-18)16-6-8-17(9-7-16)32-19(27)14-26-20(28)22(24-21(26)29)12-2-3-13-22/h4-11H,2-3,12-14H2,1H3,(H,24,29) |
| InChIKey | DWTPPWWHHVDYRD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|