C20H29N3O2 — CID 154772117
N-[2-[(3-amino-3-phenylpropanoyl)amino]ethyl]-2-methylbicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 154772117) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[2-[(3-amino-3-phenylpropanoyl)amino]ethyl]-2-methylbicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-[2-[(3-amino-3-phenylpropanoyl)amino]ethyl]-2-methylbicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 154772117 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[2-[(3-amino-3-phenylpropanoyl)amino]ethyl]-2-methylbicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC1(C(=O)NCCNC(=O)CC(N)c2ccccc2)CC2CCC1C2 |
| InChI | InChI=1S/C20H29N3O2/c1-20(13-14-7-8-16(20)11-14)19(25)23-10-9-22-18(24)12-17(21)15-5-3-2-4-6-15/h2-6,14,16-17H,7-13,21H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | XWWSIIHSKCDYDC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|