C16H15N3O5 — CID 154772535
5-(2-methoxyphenyl)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2-oxazole-4-carboxamide (PubChem CID 154772535) has the molecular formula C16H15N3O5 and a molecular weight of 329.31 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(2-methoxyphenyl)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 154772535 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 5-(2-methoxyphenyl)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2-oxazole-4-carboxamide |
| SMILES | COc1ccccc1-c1oncc1C(=O)NC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C16H15N3O5/c1-19-13(20)7-11(16(19)22)18-15(21)10-8-17-24-14(10)9-5-3-4-6-12(9)23-2/h3-6,8,11H,7H2,1-2H3,(H,18,21) |
| InChIKey | PQVRUBSRDSMHBQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|