C19H25N3O2 — CID 154772694
6-amino-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]bicyclo[3.2.0]heptane-3-carboxamide (PubChem CID 154772694) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 6-amino-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]bicyclo[3.2.0]heptane-3-carboxamide.
| Compound Name | 6-amino-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]bicyclo[3.2.0]heptane-3-carboxamide |
|---|---|
| PubChem CID | 154772694 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 6-amino-N-[2-(4-methoxy-1H-indol-3-yl)ethyl]bicyclo[3.2.0]heptane-3-carboxamide |
| SMILES | COc1cccc2[nH]cc(CCNC(=O)C3CC4CC(N)C4C3)c12 |
| InChI | InChI=1S/C19H25N3O2/c1-24-17-4-2-3-16-18(17)11(10-22-16)5-6-21-19(23)13-7-12-9-15(20)14(12)8-13/h2-4,10,12-15,22H,5-9,20H2,1H3,(H,21,23) |
| InChIKey | DUAIGCHXMMFDES-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |