C19H27N3O — CID 154772699
(3aR,7aS)-N-(5,6,7,8-tetrahydroisoquinolin-1-ylmethyl)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxamide (PubChem CID 154772699) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is (3aR,7aS)-N-(5,6,7,8-tetrahydroisoquinolin-1-ylmethyl)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxamide.
| Compound Name | (3aR,7aS)-N-(5,6,7,8-tetrahydroisoquinolin-1-ylmethyl)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxamide |
|---|---|
| PubChem CID | 154772699 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (3aR,7aS)-N-(5,6,7,8-tetrahydroisoquinolin-1-ylmethyl)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxamide |
| SMILES | O=C(NCc1nccc2c1CCCC2)[C@@]12CCCC[C@@H]1NCC2 |
| InChI | InChI=1S/C19H27N3O/c23-18(19-9-4-3-7-17(19)21-12-10-19)22-13-16-15-6-2-1-5-14(15)8-11-20-16/h8,11,17,21H,1-7,9-10,12-13H2,(H,22,23)/t17-,19+/m0/s1 |
| InChIKey | IGZCBBYCLXVYSI-PKOBYXMFSA-N |
| XLogP | 2.50 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |