C21H28N4O2 — CID 154773254
N-[(2-pentyl-1,3-dihydroisoindol-5-yl)methyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide (PubChem CID 154773254) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[(2-pentyl-1,3-dihydroisoindol-5-yl)methyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide.
| Compound Name | N-[(2-pentyl-1,3-dihydroisoindol-5-yl)methyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 154773254 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-[(2-pentyl-1,3-dihydroisoindol-5-yl)methyl]-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxamide |
| SMILES | CCCCCN1Cc2ccc(CNC(=O)c3cc4n(n3)CCCO4)cc2C1 |
| InChI | InChI=1S/C21H28N4O2/c1-2-3-4-8-24-14-17-7-6-16(11-18(17)15-24)13-22-21(26)19-12-20-25(23-19)9-5-10-27-20/h6-7,11-12H,2-5,8-10,13-15H2,1H3,(H,22,26) |
| InChIKey | CMZIGVHJRVOZLC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|