About 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one
5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one (PubChem CID 154773404) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one |
| PubChem CID | 154773404 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)c1cnc(-c2ccc(C3CCC(=O)N3)cc2)o1 |
| InChI | InChI=1S/C17H20N2O2/c1-17(2,3)14-10-18-16(21-14)12-6-4-11(5-7-12)13-8-9-15(20)19-13/h4-7,10,13H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | IGKJAMCZUXESQD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one?
The IUPAC name of 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one (CID 154773404) is 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one?
The canonical SMILES for 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one is CC(C)(C)c1cnc(-c2ccc(C3CCC(=O)N3)cc2)o1.
What is the InChIKey of 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one?
The InChIKey is IGKJAMCZUXESQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c1-17(2,3)14-10-18-16(21-14)12-6-4-11(5-7-12)13-8-9-15(20)19-13/h4-7,10,13H,8-9H2,1-3H3,(H,19,20).
What are the key properties of 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one?
5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one has a molecular weight of 284.36 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(5-tert-butyl-1,3-oxazol-2-yl)phenyl]pyrrolidin-2-one is sourced from PubChem (CID 154773404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).