C14H15FN2O4 — CID 154774254
(1-amino-1-oxopropan-2-yl) 1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 154774254) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 154774254 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CC(OC(=O)C1CC(=O)N(c2ccccc2F)C1)C(N)=O |
| InChI | InChI=1S/C14H15FN2O4/c1-8(13(16)19)21-14(20)9-6-12(18)17(7-9)11-5-3-2-4-10(11)15/h2-5,8-9H,6-7H2,1H3,(H2,16,19) |
| InChIKey | HRYZHCNATBZJMO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |