C17H22N4O11 — CID 154774376
5-[[4,5,6-trihydroxy-7-(hydroxymethyl)oxocan-3-yl]-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 154774376) has the molecular formula C17H22N4O11 and a molecular weight of 458.38 g/mol. Its IUPAC name is 5-[[4,5,6-trihydroxy-7-(hydroxymethyl)oxocan-3-yl]-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4,5,6-trihydroxy-7-(hydroxymethyl)oxocan-3-yl]-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 154774376 |
| Molecular Formula | C17H22N4O11 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 5-[[4,5,6-trihydroxy-7-(hydroxymethyl)oxocan-3-yl]-(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(C(C2C(=O)NC(=O)NC2=O)C2COCC(CO)C(O)C(O)C2O)C(=O)N1 |
| InChI | InChI=1S/C17H22N4O11/c22-1-4-2-32-3-5(10(24)11(25)9(4)23)6(7-12(26)18-16(30)19-13(7)27)8-14(28)20-17(31)21-15(8)29/h4-11,22-25H,1-3H2,(H2,18,19,26,27,30)(H2,20,21,28,29,31) |
| InChIKey | BLXXXMJJMATGBI-UHFFFAOYSA-N |
| XLogP | -5.10 |
| TPSA | 240.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | -5.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|