C16H23N7O — CID 154775389
1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[methyl(7H-purin-6-yl)amino]ethanone (PubChem CID 154775389) has the molecular formula C16H23N7O and a molecular weight of 329.41 g/mol. Its IUPAC name is 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[methyl(7H-purin-6-yl)amino]ethanone.
| Compound Name | 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[methyl(7H-purin-6-yl)amino]ethanone |
|---|---|
| PubChem CID | 154775389 |
| Molecular Formula | C16H23N7O |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2-[methyl(7H-purin-6-yl)amino]ethanone |
| SMILES | CN(CC(=O)N1CCN2CCCCC2C1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H23N7O/c1-21(16-14-15(18-10-17-14)19-11-20-16)9-13(24)23-7-6-22-5-3-2-4-12(22)8-23/h10-12H,2-9H2,1H3,(H,17,18,19,20) |
| InChIKey | ZPLATWIOQQRVBZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |