C14H22FN5O — CID 15477550
N-[4-(1-cyclohexylethylamino)-6-(1-fluoroethyl)-1,3,5-triazin-2-yl]formamide (PubChem CID 15477550) has the molecular formula C14H22FN5O and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[4-(1-cyclohexylethylamino)-6-(1-fluoroethyl)-1,3,5-triazin-2-yl]formamide.
| Compound Name | N-[4-(1-cyclohexylethylamino)-6-(1-fluoroethyl)-1,3,5-triazin-2-yl]formamide |
|---|---|
| PubChem CID | 15477550 |
| Molecular Formula | C14H22FN5O |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[4-(1-cyclohexylethylamino)-6-(1-fluoroethyl)-1,3,5-triazin-2-yl]formamide |
| SMILES | CC(F)c1nc(NC=O)nc(NC(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C14H22FN5O/c1-9(15)12-18-13(16-8-21)20-14(19-12)17-10(2)11-6-4-3-5-7-11/h8-11H,3-7H2,1-2H3,(H2,16,17,18,19,20,21) |
| InChIKey | YXMPJCABUWFLSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|