C15H24FN5O — CID 15477555
N-[4-(1-cyclohexylethylamino)-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-yl]formamide (PubChem CID 15477555) has the molecular formula C15H24FN5O and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[4-(1-cyclohexylethylamino)-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-yl]formamide.
| Compound Name | N-[4-(1-cyclohexylethylamino)-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-yl]formamide |
|---|---|
| PubChem CID | 15477555 |
| Molecular Formula | C15H24FN5O |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[4-(1-cyclohexylethylamino)-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-yl]formamide |
| SMILES | CC(Nc1nc(NC=O)nc(C(C)(C)F)n1)C1CCCCC1 |
| InChI | InChI=1S/C15H24FN5O/c1-10(11-7-5-4-6-8-11)18-14-20-12(15(2,3)16)19-13(21-14)17-9-22/h9-11H,4-8H2,1-3H3,(H2,17,18,19,20,21,22) |
| InChIKey | OIMJGXKFBDFVAQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|