C12H18ClF2N5 — CID 15477563
6-[chloro(difluoro)methyl]-2-N-(1-cyclohexylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 15477563) has the molecular formula C12H18ClF2N5 and a molecular weight of 305.76 g/mol. Its IUPAC name is 6-[chloro(difluoro)methyl]-2-N-(1-cyclohexylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[chloro(difluoro)methyl]-2-N-(1-cyclohexylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 15477563 |
| Molecular Formula | C12H18ClF2N5 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 6-[chloro(difluoro)methyl]-2-N-(1-cyclohexylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Nc1nc(N)nc(C(F)(F)Cl)n1)C1CCCCC1 |
| InChI | InChI=1S/C12H18ClF2N5/c1-7(8-5-3-2-4-6-8)17-11-19-9(12(13,14)15)18-10(16)20-11/h7-8H,2-6H2,1H3,(H3,16,17,18,19,20) |
| InChIKey | WCANSQIFBBFJBS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|