C15H18N4O3S — CID 154775810
N-[3-(2-hydroxyethylsulfanyl)-1H-1,2,4-triazol-5-yl]-3-(3-methoxyphenyl)but-2-enamide (PubChem CID 154775810) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[3-(2-hydroxyethylsulfanyl)-1H-1,2,4-triazol-5-yl]-3-(3-methoxyphenyl)but-2-enamide.
| Compound Name | N-[3-(2-hydroxyethylsulfanyl)-1H-1,2,4-triazol-5-yl]-3-(3-methoxyphenyl)but-2-enamide |
|---|---|
| PubChem CID | 154775810 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-[3-(2-hydroxyethylsulfanyl)-1H-1,2,4-triazol-5-yl]-3-(3-methoxyphenyl)but-2-enamide |
| SMILES | COc1cccc(C(C)=CC(=O)Nc2nc(SCCO)n[nH]2)c1 |
| InChI | InChI=1S/C15H18N4O3S/c1-10(11-4-3-5-12(9-11)22-2)8-13(21)16-14-17-15(19-18-14)23-7-6-20/h3-5,8-9,20H,6-7H2,1-2H3,(H2,16,17,18,19,21) |
| InChIKey | SNWUYQKAJYHTHP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|