About 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide
2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 15477602) has the molecular formula C9H11N3O4S2
and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide |
| PubChem CID | 15477602 |
| Molecular Formula | C9H11N3O4S2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CCS(=O)(=O)c1nc2ccccn2c1S(N)(=O)=O |
| InChI | InChI=1S/C9H11N3O4S2/c1-2-17(13,14)8-9(18(10,15)16)12-6-4-3-5-7(12)11-8/h3-6H,2H2,1H3,(H2,10,15,16) |
| InChIKey | MJVXHAPMFSPZRH-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide?
The IUPAC name of 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide (CID 15477602) is 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide.
What is the SMILES notation for 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide?
The canonical SMILES for 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide is CCS(=O)(=O)c1nc2ccccn2c1S(N)(=O)=O.
What is the InChIKey of 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide?
The InChIKey is MJVXHAPMFSPZRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O4S2/c1-2-17(13,14)8-9(18(10,15)16)12-6-4-3-5-7(12)11-8/h3-6H,2H2,1H3,(H2,10,15,16).
What are the key properties of 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide?
2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide has a molecular weight of 289.34 g/mol, XLogP of -0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonylimidazo[1,2-a]pyridine-3-sulfonamide is sourced from PubChem (CID 15477602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).