C8H13Cl3N2 — CID 154776295
2-(chloromethyl)-N,N-dimethylpyridin-4-amine;dihydrochloride (PubChem CID 154776295) has the molecular formula C8H13Cl3N2 and a molecular weight of 243.56 g/mol. Its IUPAC name is 2-(chloromethyl)-N,N-dimethylpyridin-4-amine;dihydrochloride.
| Compound Name | 2-(chloromethyl)-N,N-dimethylpyridin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 154776295 |
| Molecular Formula | C8H13Cl3N2 |
| Molecular Weight | 243.56 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 2-(chloromethyl)-N,N-dimethylpyridin-4-amine;dihydrochloride |
| SMILES | CN(C)c1ccnc(CCl)c1.Cl.Cl |
| InChI | InChI=1S/C8H11ClN2.2ClH/c1-11(2)8-3-4-10-7(5-8)6-9;;/h3-5H,6H2,1-2H3;2*1H |
| InChIKey | BBTSSHTWFBGFEB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|