C15H20N2O2 — CID 15477837
4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)phenolate (PubChem CID 15477837) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)phenolate.
| Compound Name | 4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)phenolate |
|---|---|
| PubChem CID | 15477837 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-hydroxy-2-(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-5-ium-1-yl)phenolate |
| SMILES | [O-]c1ccc(O)cc1N1CCC[N+]2=C1CCCCC2 |
| InChI | InChI=1S/C15H20N2O2/c18-12-6-7-14(19)13(11-12)17-10-4-9-16-8-3-1-2-5-15(16)17/h6-7,11H,1-5,8-10H2,(H-,18,19) |
| InChIKey | QVEYNFZXEDTWAY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|