C18H25N3O2 — CID 154778636
[(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone (PubChem CID 154778636) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone.
| Compound Name | [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 154778636 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [(3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)nc1)N1CC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C18H25N3O2/c22-18(21-8-7-14-3-1-2-4-16(14)21)15-5-6-17(19-13-15)20-9-11-23-12-10-20/h5-6,13-14,16H,1-4,7-12H2/t14-,16-/m0/s1 |
| InChIKey | NADBJTOJNZKDFH-HOCLYGCPSA-N |
| XLogP | 2.32 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |