About 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide
1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide (PubChem CID 154779770) has the molecular formula C11H14N4O2S2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide.
Molecular Properties
| Compound Name | 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide |
| PubChem CID | 154779770 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide |
| SMILES | NS(=O)(=O)C1(CNc2ncnc3ccsc23)CCC1 |
| InChI | InChI=1S/C11H14N4O2S2/c12-19(16,17)11(3-1-4-11)6-13-10-9-8(2-5-18-9)14-7-15-10/h2,5,7H,1,3-4,6H2,(H2,12,16,17)(H,13,14,15) |
| InChIKey | OPMGDILOOLXRHT-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide?
The IUPAC name of 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide (CID 154779770) is 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide.
What is the SMILES notation for 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide?
The canonical SMILES for 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide is NS(=O)(=O)C1(CNc2ncnc3ccsc23)CCC1.
What is the InChIKey of 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide?
The InChIKey is OPMGDILOOLXRHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S2/c12-19(16,17)11(3-1-4-11)6-13-10-9-8(2-5-18-9)14-7-15-10/h2,5,7H,1,3-4,6H2,(H2,12,16,17)(H,13,14,15).
What are the key properties of 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide?
1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide has a molecular weight of 298.39 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(thieno[3,2-d]pyrimidin-4-ylamino)methyl]cyclobutane-1-sulfonamide is sourced from PubChem (CID 154779770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).