C16H17FN4O — CID 154779946
[2-(2-fluorophenyl)azetidin-1-yl]-[6-methyl-2-(methylamino)pyrimidin-4-yl]methanone (PubChem CID 154779946) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is [2-(2-fluorophenyl)azetidin-1-yl]-[6-methyl-2-(methylamino)pyrimidin-4-yl]methanone.
| Compound Name | [2-(2-fluorophenyl)azetidin-1-yl]-[6-methyl-2-(methylamino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 154779946 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [2-(2-fluorophenyl)azetidin-1-yl]-[6-methyl-2-(methylamino)pyrimidin-4-yl]methanone |
| SMILES | CNc1nc(C)cc(C(=O)N2CCC2c2ccccc2F)n1 |
| InChI | InChI=1S/C16H17FN4O/c1-10-9-13(20-16(18-2)19-10)15(22)21-8-7-14(21)11-5-3-4-6-12(11)17/h3-6,9,14H,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | TVGGCLJBVNWCMW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |