About 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine
4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine (PubChem CID 15478016) has the molecular formula C13H12BNO2
and a molecular weight of 225.06 g/mol. Its IUPAC name is 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine.
Molecular Properties
| Compound Name | 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine |
| PubChem CID | 15478016 |
| Molecular Formula | C13H12BNO2 |
| Molecular Weight | 225.06 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine |
| SMILES | c1ccc2c(c1)OB(CCc1ccncc1)O2 |
| InChI | InChI=1S/C13H12BNO2/c1-2-4-13-12(3-1)16-14(17-13)8-5-11-6-9-15-10-7-11/h1-4,6-7,9-10H,5,8H2 |
| InChIKey | QBKYXGVKMYHEGK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.06 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine?
The IUPAC name of 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine (CID 15478016) is 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine.
What is the SMILES notation for 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine?
The canonical SMILES for 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine is c1ccc2c(c1)OB(CCc1ccncc1)O2.
What is the InChIKey of 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine?
The InChIKey is QBKYXGVKMYHEGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BNO2/c1-2-4-13-12(3-1)16-14(17-13)8-5-11-6-9-15-10-7-11/h1-4,6-7,9-10H,5,8H2.
What are the key properties of 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine?
4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine has a molecular weight of 225.06 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3,2-benzodioxaborol-2-yl)ethyl]pyridine is sourced from PubChem (CID 15478016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).