C16H22ClFN2O — CID 154780291
1-(3-chloro-5-fluorophenyl)-2-[(1-cyclopropyl-5-methylpyrrolidin-3-yl)amino]ethanol (PubChem CID 154780291) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-2-[(1-cyclopropyl-5-methylpyrrolidin-3-yl)amino]ethanol.
| Compound Name | 1-(3-chloro-5-fluorophenyl)-2-[(1-cyclopropyl-5-methylpyrrolidin-3-yl)amino]ethanol |
|---|---|
| PubChem CID | 154780291 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-2-[(1-cyclopropyl-5-methylpyrrolidin-3-yl)amino]ethanol |
| SMILES | CC1CC(NCC(O)c2cc(F)cc(Cl)c2)CN1C1CC1 |
| InChI | InChI=1S/C16H22ClFN2O/c1-10-4-14(9-20(10)15-2-3-15)19-8-16(21)11-5-12(17)7-13(18)6-11/h5-7,10,14-16,19,21H,2-4,8-9H2,1H3 |
| InChIKey | SCHNWAGXUIFFJI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |