C14H17N3O3S2 — CID 154780639
N-methyl-1-thieno[3,2-b]pyridin-6-ylsulfonylpiperidine-2-carboxamide (PubChem CID 154780639) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-methyl-1-thieno[3,2-b]pyridin-6-ylsulfonylpiperidine-2-carboxamide.
| Compound Name | N-methyl-1-thieno[3,2-b]pyridin-6-ylsulfonylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 154780639 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-methyl-1-thieno[3,2-b]pyridin-6-ylsulfonylpiperidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCCN1S(=O)(=O)c1cnc2ccsc2c1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-15-14(18)12-4-2-3-6-17(12)22(19,20)10-8-13-11(16-9-10)5-7-21-13/h5,7-9,12H,2-4,6H2,1H3,(H,15,18) |
| InChIKey | IADNDRLHLBZYKE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |