C15H13N5O2 — CID 154780959
6-(4-methoxybut-2-ynyl)-3-phenyltriazolo[4,5-d]pyrimidin-7-one (PubChem CID 154780959) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is 6-(4-methoxybut-2-ynyl)-3-phenyltriazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 6-(4-methoxybut-2-ynyl)-3-phenyltriazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 154780959 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 6-(4-methoxybut-2-ynyl)-3-phenyltriazolo[4,5-d]pyrimidin-7-one |
| SMILES | COCC#CCn1cnc2c(nnn2-c2ccccc2)c1=O |
| InChI | InChI=1S/C15H13N5O2/c1-22-10-6-5-9-19-11-16-14-13(15(19)21)17-18-20(14)12-7-3-2-4-8-12/h2-4,7-8,11H,9-10H2,1H3 |
| InChIKey | BHMQXDPLLPGNRG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|