C20H20N4O2 — CID 154781982
(3R,4S)-3-benzyl-N-cinnolin-3-yl-4-hydroxypyrrolidine-1-carboxamide (PubChem CID 154781982) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (3R,4S)-3-benzyl-N-cinnolin-3-yl-4-hydroxypyrrolidine-1-carboxamide.
| Compound Name | (3R,4S)-3-benzyl-N-cinnolin-3-yl-4-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 154781982 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3R,4S)-3-benzyl-N-cinnolin-3-yl-4-hydroxypyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cc2ccccc2nn1)N1C[C@@H](Cc2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C20H20N4O2/c25-18-13-24(12-16(18)10-14-6-2-1-3-7-14)20(26)21-19-11-15-8-4-5-9-17(15)22-23-19/h1-9,11,16,18,25H,10,12-13H2,(H,21,23,26)/t16-,18-/m1/s1 |
| InChIKey | RWSLZDXRIAWLAC-SJLPKXTDSA-N |
| XLogP | 2.70 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |