About 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide
2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 154781994) has the molecular formula C16H23F2N3O2
and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 154781994 |
| Molecular Formula | C16H23F2N3O2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H23F2N3O2/c1-9-11(13(23)21-14(19-9)15(2,3)4)12(22)20-10-5-7-16(17,18)8-6-10/h10H,5-8H2,1-4H3,(H,20,22)(H,19,21,23) |
| InChIKey | OFZQGHGNUNGTSP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide (CID 154781994) is 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide is Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)NC1CCC(F)(F)CC1.
What is the InChIKey of 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide?
The InChIKey is OFZQGHGNUNGTSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F2N3O2/c1-9-11(13(23)21-14(19-9)15(2,3)4)12(22)20-10-5-7-16(17,18)8-6-10/h10H,5-8H2,1-4H3,(H,20,22)(H,19,21,23).
What are the key properties of 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide?
2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide has a molecular weight of 327.38 g/mol, XLogP of 2.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-(4,4-difluorocyclohexyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 154781994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).