C16H21FN2O4 — CID 154782276
1-[[1-(4-fluorophenyl)-2-methoxyethyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 154782276) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is 1-[[1-(4-fluorophenyl)-2-methoxyethyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[1-(4-fluorophenyl)-2-methoxyethyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 154782276 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[[1-(4-fluorophenyl)-2-methoxyethyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | COCC(NC(=O)N1CCC(C)(C(=O)O)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O4/c1-16(14(20)21)7-8-19(10-16)15(22)18-13(9-23-2)11-3-5-12(17)6-4-11/h3-6,13H,7-10H2,1-2H3,(H,18,22)(H,20,21) |
| InChIKey | HAPMZAFPXIVFHT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |