C18H18FN3O3 — CID 154782566
(3R)-3-[5-(5-fluoro-1-benzofuran-7-yl)-1,2,4-oxadiazol-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine (PubChem CID 154782566) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is (3R)-3-[5-(5-fluoro-1-benzofuran-7-yl)-1,2,4-oxadiazol-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine.
| Compound Name | (3R)-3-[5-(5-fluoro-1-benzofuran-7-yl)-1,2,4-oxadiazol-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 154782566 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (3R)-3-[5-(5-fluoro-1-benzofuran-7-yl)-1,2,4-oxadiazol-3-yl]-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine |
| SMILES | Fc1cc(-c2nc([C@H]3CN4CCCCC4CO3)no2)c2occc2c1 |
| InChI | InChI=1S/C18H18FN3O3/c19-12-7-11-4-6-23-16(11)14(8-12)18-20-17(21-25-18)15-9-22-5-2-1-3-13(22)10-24-15/h4,6-8,13,15H,1-3,5,9-10H2/t13?,15-/m1/s1 |
| InChIKey | YBVDGHGUHXDVEK-AWKYBWMHSA-N |
| XLogP | 3.55 |
| TPSA | 64.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |